|
- Brand:hebei qujie
- Model:25kg/Bag
- Purity:99%
- Cas:74-79-3
- Createtime: 2026-05-26
- Updatetime: 2026-09-30
| useage | Used as moisturizer and preservative in personal care products. |
| deliveryInfo | |
| appearance | white powder |
| aliasen | |
| supplyCapacity | 90T/Month |
| harbor | tianjin qingdao shanghai |
| minorder | 1KG |
Description:
Arginine, chemical formula C6H14N4O2, molecular weight 174.20, is an amino acid compound. It participates in the ornithine cycle in the human body and promotes the formation of urea. There is a high concentration of hydrogen ions, which helps to correct the acid-base balance in hepatic encephalopathy. Together with histidine and lysine, it is a basic amino acid.
.
Application:
1. For biochemical research, all kinds of liver coma and viral liver glutamic-pyruginoid transaminase abnormal.
2. As a nutritional supplement and seasoning agent. A heating reaction with sugar (aminocarbonyl reaction) can obtain a special flavor substance. GB 2760-2001 specifies the permissible use of spices for food.
3. Arginine is an essential amino acid for infant growth and development. It is an intermediate metabolite of the ornithine cycle and can promote urea formation. It is also the main component of sperm protein, has the role of promoting sperm production and providing sperm movement energy. In addition, intravenous injection of arginine can stimulate the pituitary to release GH, which can be used for pituitary function test.
Product Parameters
| EINECS | 200-811-1 |
| chemical formula | C6H14N4O2 |
| Molecular weight | 174.2 |
| InChI | InChI=1/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/p+1/t4-/m0/s1 |
| InChIKey | ODKSFYDXXFIFQN-BYPYZUCNSA-N |
| density | 1.2297 (rough estimate) |
| Melting point | 222 °C (dec.) (lit.) |
| Boiling point | 305.18°C (rough estimate) |
| Compare the rotation of luminosity | 27.1 o (c=8, 6N HCl) |
| Flash point | 201.2°C |
| Water solubility | 148.7 g/L (20 oC) |
| Vapor pressure | 7.7E-08mmHg at 25°C |
| JECFA Number | 1438 |
| Solubility | H2O: 100 mg/mL |
| Refractive index | 27 ° (C=8, 6mol/L HC |
| Acidity coefficient | 1.82, 8.99, 12.5(at 25℃) |
| pH value | 10.5-12.0 (25℃, 0.5M in H2O) |
| Storage conditions | 2-8°C |
| Stability | Stable. Not compatible with strong oxidizers. |
Detailed Photos


